Online Database of Chemicals from Around the World
|
CAS#: 794448-68-3 Product: 7-Methoxy-1-methyl-3,4-dihydro-2H-beta-carboline No suppilers available for the product. |
| Name | 7-Methoxy-1-methyl-3,4-dihydro-2H-beta-carboline |
|---|---|
| Synonyms | 1-Methyl-7-methoxy-3, 4-dihydro-β-carboline; 1-Methyl-7-methoxy-3,4-dihydro-β-carboline; 3, 4-Dihydro-7-methoxy-1-methyl-9-pyrid[3,4-b]indole |
| Molecular Structure |  |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.26 |
| CAS Registry Number | 794448-68-3 |
| SMILES | O(C=2/C=C\C1=C3C(\N=C1C=2)=C(/NCC3)C)C |
| InChI | 1S/C13H14N2O/c1-8-13-11(5-6-14-8)10-4-3-9(16-2)7-12(10)15-13/h3-4,7,14H,5-6H2,1-2H3 |
| InChIKey | QJOZJXNKVMFAET-UHFFFAOYSA-N |
| Density | 1.257g/cm3 (Cal.) |
|---|---|
| Boiling point | 426.415°C at 760 mmHg (Cal.) |
| Flash point | 211.688°C (Cal.) |
| Refractive index | 1.647 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Methoxy-1-methyl-3,4-dihydro-2H-beta-carboline |