Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N4,N4-Diethyl-2,4,6-pyridinetriamine 1-oxide |
|---|---|
| Synonyms | 2,6-diamino-4-(diethylamino)pyridine 1-oxide |
| Molecular Structure |  |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 |
| CAS Registry Number | 79459-02-2 |
| SMILES | Nc1cc(cc(N)[n+]1[O-])N(CC)CC |
| InChI | 1S/C9H16N4O/c1-3-12(4-2)7-5-8(10)13(14)9(11)6-7/h5-6H,3-4,10-11H2,1-2H3 |
| InChIKey | YWDDLSTZKWZYFV-UHFFFAOYSA-N |
| Density | 1.229g/cm3 (Cal.) |
|---|---|
| Boiling point | 480.176°C at 760 mmHg (Cal.) |
| Flash point | 244.202°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N4,N4-Diethyl-2,4,6-pyridinetriamine 1-oxide |