Online Database of Chemicals from Around the World
|
CAS#: 79476-53-2 Product: 2-(2,6-Dinitrophenyl)-N,N-dimethylethenamine No suppilers available for the product. |
| Name | 2-(2,6-Dinitrophenyl)-N,N-dimethylethenamine |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C10H11N3O4 |
| Molecular Weight | 237.21 |
| CAS Registry Number | 79476-53-2 |
| SMILES | [O-][N+](=O)c1cccc([N+]([O-])=O)c1C=CN(C)C |
| InChI | 1S/C10H11N3O4/c1-11(2)7-6-8-9(12(14)15)4-3-5-10(8)13(16)17/h3-7H,1-2H3 |
| InChIKey | FTGPISCZYQYHPV-UHFFFAOYSA-N |
| Density | 1.334g/cm3 (Cal.) |
|---|---|
| Boiling point | 386.245°C at 760 mmHg (Cal.) |
| Flash point | 187.395°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-(2,6-Dinitrophenyl)-N,N-dimethylethenamine |