| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Biochemical >> Plant extracts |
|---|---|
| Name | Danshenrootextract |
| Synonyms | 1,6-Dimethyl-8,9-Dihydronaphtho[8,7-G]Benzofuran-10,11-Dione; 1-Methyl-6-Methylene-8,9-Dihydro-7H-Naphtho[8,7-G]Benzofuran-10,11-Dione; 1,6-Dimethyl-8,9-Dihydronaphtho[8,7-G]Benzofuran-10,11-Quinone; 1-Methyl-6-Methylene-8,9-Dihydro-7H-Naphtho[8,7-G]Benzofuran-10,11-Quinone; Phenanthro(1,2-B)Furan-10,11-Dione, 8,9-Dihydro-1,6-Dimethyl-, Mixt. With 6,7,8,9-Tetrahydro-1-Methyl-6-Methylenephenanthro(1,2-B)Furan-10,11-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C36H28O6 |
| Molecular Weight | 556.61 |
| CAS Registry Number | 79483-68-4 |
| SMILES | C1=CC4=C(C2=C1C3=C(C(=O)C2=O)C(=CO3)C)CCC=C4C.C5=CC8=C(C6=C5C7=C(C(=O)C6=O)C(=CO7)C)CCCC8=C |
| InChI | 1S/2C18H14O3/c2*1-9-4-3-5-12-11(9)6-7-13-15(12)17(20)16(19)14-10(2)8-21-18(13)14/h4,6-8H,3,5H2,1-2H3;6-8H,1,3-5H2,2H3 |
| InChIKey | WTPPRJKFRFIQKT-UHFFFAOYSA-N |
| Boiling point | 495.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 244.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Danshenrootextract |