Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (2S,3R)-2-Allyl-3-methylcyclohexanone |
|---|---|
| Synonyms | (2S,3R)-2-allyl-3-methylcyclohexanone |
| Molecular Structure |  |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.23 |
| CAS Registry Number | 795275-74-0 |
| SMILES | O=C1[C@@H](C\C=C)[C@H](C)CCC1 |
| InChI | 1S/C10H16O/c1-3-5-9-8(2)6-4-7-10(9)11/h3,8-9H,1,4-7H2,2H3/t8-,9+/m1/s1 |
| InChIKey | JNDGVJUNFDJOLD-BDAKNGLRSA-N |
| Density | 0.884g/cm3 (Cal.) |
|---|---|
| Boiling point | 210.194°C at 760 mmHg (Cal.) |
| Flash point | 75.774°C (Cal.) |
| Refractive index | 1.449 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S,3R)-2-Allyl-3-methylcyclohexanone |