Online Database of Chemicals from Around the World
|
CAS#: 79570-06-2 Product: (2E)-3-(3,3-Dimethylbicyclo[2.2.1]hept-2-yl)acrylonitrile No suppilers available for the product. |
| Name | (2E)-3-(3,3-Dimethylbicyclo[2.2.1]hept-2-yl)acrylonitrile |
|---|---|
| Synonyms | 3-(3,3-dimethylbicyclo[2.2.1]hept-2-yl)acrylonitrile |
| Molecular Structure | ![CAS#: 79570-06-2， (2E)-3-(3,3-Dimethylbicyclo[2.2.1]hept-2-yl)acrylonitrile](/moreStructures/79570-06-2.gif) |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 |
| CAS Registry Number | 79570-06-2 |
| EINECS | 279-187-8 |
| SMILES | CC2(C)C(\C=C\C#N)C1CCC2C1 |
| InChI | 1S/C12H17N/c1-12(2)10-6-5-9(8-10)11(12)4-3-7-13/h3-4,9-11H,5-6,8H2,1-2H3/b4-3+ |
| InChIKey | OJJBGBXYELHVSF-ONEGZZNKSA-N |
| Density | 1.014g/cm3 (Cal.) |
|---|---|
| Boiling point | 263.671°C at 760 mmHg (Cal.) |
| Flash point | 113.387°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2E)-3-(3,3-Dimethylbicyclo[2.2.1]hept-2-yl)acrylonitrile |