Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (1S,2R)-1-Fluoro-2-isopropylcyclopropanecarboxylic acid |
|---|---|
| Synonyms | (1S,2R)-1-fluoro-2-isopropylcyclopropanecarboxylic acid |
| Molecular Structure |  |
| Molecular Formula | C7H11FO2 |
| Molecular Weight | 146.16 |
| CAS Registry Number | 79658-33-6 |
| SMILES | CC(C)[C@H]1C[C@]1(C(=O)O)F |
| InChI | 1S/C7H11FO2/c1-4(2)5-3-7(5,8)6(9)10/h4-5H,3H2,1-2H3,(H,9,10)/t5-,7+/m1/s1 |
| InChIKey | QQBMHOMBYVWDHU-VDTYLAMSSA-N |
| Density | 1.148g/cm3 (Cal.) |
|---|---|
| Boiling point | 200.433°C at 760 mmHg (Cal.) |
| Flash point | 75.019°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1S,2R)-1-Fluoro-2-isopropylcyclopropanecarboxylic acid |