| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | 2-Methyl-2-propanyl (1-methyl-1H-pyrazol-4-yl)carbamate |
|---|---|
| Synonyms | (tert-butoxy)-N-(1-methylpyrazol-4-yl)carboxamide; tert-butyl 1-methyl-1H-pyrazol-4-ylcarbamate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.23 |
| CAS Registry Number | 796845-64-2 |
| SMILES | CC(C)(C)OC(=O)Nc1cnn(c1)C |
| InChI | 1S/C9H15N3O2/c1-9(2,3)14-8(13)11-7-5-10-12(4)6-7/h5-6H,1-4H3,(H,11,13) |
| InChIKey | OPDHRWAOWFEPAW-UHFFFAOYSA-N |
| Density | 1.128g/cm3 (Cal.) |
|---|---|
| Boiling point | 259.993°C at 760 mmHg (Cal.) |
| Flash point | 111.04°C (Cal.) |
| Refractive index | 1.525 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-propanyl (1-methyl-1H-pyrazol-4-yl)carbamate |