Online Database of Chemicals from Around the World
|
CAS#: 79720-24-4 Product: Hexahydro-4-methyl-N-(2,2,6,6-tetramethyl-4-piperidyl)phthalimide No suppilers available for the product. |
| Name | Hexahydro-4-methyl-N-(2,2,6,6-tetramethyl-4-piperidyl)phthalimide |
|---|---|
| Synonyms | 5-Methyl-2-(2,2,6,6-Tetramethyl-4-Piperidyl)-3A,4,5,6,7,7A-Hexahydroisoindole-1,3-Dione; 5-Methyl-2-(2,2,6,6-Tetramethyl-4-Piperidinyl)-3A,4,5,6,7,7A-Hexahydroisoindole-1,3-Dione; 5-Methyl-2-(2,2,6,6-Tetramethyl-4-Piperidyl)-3A,4,5,6,7,7A-Hexahydroisoindole-1,3-Quinone |
| Molecular Structure |  |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 |
| CAS Registry Number | 79720-24-4 |
| EINECS | 279-245-2 |
| SMILES | CC3(NC(CC(N1C(=O)C2C(C1=O)CCC(C2)C)C3)(C)C)C |
| InChI | 1S/C18H30N2O2/c1-11-6-7-13-14(8-11)16(22)20(15(13)21)12-9-17(2,3)19-18(4,5)10-12/h11-14,19H,6-10H2,1-5H3 |
| InChIKey | WWHKCKYSXZTSEP-UHFFFAOYSA-N |
| Density | 1.029g/cm3 (Cal.) |
|---|---|
| Boiling point | 422.446°C at 760 mmHg (Cal.) |
| Flash point | 209.288°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Hexahydro-4-methyl-N-(2,2,6,6-tetramethyl-4-piperidyl)phthalimide |