Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 6-Hydroxy-2,2',4,4'-Tetrabromodiphenyl Ether |
|---|---|
| Synonyms | Bpe-5; Phenol, 3,5-Dibromo-2-(2,4-Dibromophenoxy)- |
| Molecular Structure |  |
| Molecular Formula | C12H6Br4O2 |
| Molecular Weight | 501.79 |
| CAS Registry Number | 79755-43-4 |
| SMILES | C1=C(C(=C(C=C1Br)O)OC2=CC=C(Br)C=C2Br)Br |
| InChI | 1S/C12H6Br4O2/c13-6-1-2-11(8(15)3-6)18-12-9(16)4-7(14)5-10(12)17/h1-5,17H |
| InChIKey | SNCQITRZEBFIRW-UHFFFAOYSA-N |
| Density | 2.248g/cm3 (Cal.) |
|---|---|
| Boiling point | 405.933°C at 760 mmHg (Cal.) |
| Flash point | 199.301°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Hydroxy-2,2',4,4'-Tetrabromodiphenyl Ether |