Online Database of Chemicals from Around the World
|
CAS#: 79792-97-5 Product: 2-Propylsulfanylbenzenesulfonamide No suppilers available for the product. |
| Name | 2-Propylsulfanylbenzenesulfonamide |
|---|---|
| Synonyms | 2-(Propylthio)Benzenesulfonamide; O-(Propylthio)Benzenesulphonamide |
| Molecular Structure |  |
| Molecular Formula | C9H13NO2S2 |
| Molecular Weight | 231.33 |
| CAS Registry Number | 79792-97-5 |
| EINECS | 279-265-1 |
| SMILES | C1=CC=CC(=C1[S](=O)(=O)N)SCCC |
| InChI | 1S/C9H13NO2S2/c1-2-7-13-8-5-3-4-6-9(8)14(10,11)12/h3-6H,2,7H2,1H3,(H2,10,11,12) |
| InChIKey | YUELPEBMYBAWNG-UHFFFAOYSA-N |
| Density | 1.309g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.732°C at 760 mmHg (Cal.) |
| Flash point | 189.503°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Propylsulfanylbenzenesulfonamide |