|
CAS#: 79801-89-1 Product: 3-Ethyl-9H-Pyrido[6,5-b]Indol-2-Amine No suppilers available for the product. |
| Name | 3-Ethyl-9H-Pyrido[6,5-b]Indol-2-Amine |
|---|---|
| Synonyms | (3-Ethyl-9H-Pyrido[6,5-B]Indol-2-Yl)Amine; 2-Amino-3-Ethyl-9H-Pyrido(2,3-B)Indole; 9H-Pyrido(2,3-B)Indol-2-Amine, 3-Ethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 |
| CAS Registry Number | 79801-89-1 |
| SMILES | C1=C2C(=NC(=C1CC)N)[NH]C3=CC=CC=C23 |
| InChI | 1S/C13H13N3/c1-2-8-7-10-9-5-3-4-6-11(9)15-13(10)16-12(8)14/h3-7H,2H2,1H3,(H3,14,15,16) |
| InChIKey | RKINWDQHLUWOSH-UHFFFAOYSA-N |
| Density | 1.286g/cm3 (Cal.) |
|---|---|
| Boiling point | 439.895°C at 760 mmHg (Cal.) |
| Flash point | 250.018°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Ethyl-9H-Pyrido[6,5-b]Indol-2-Amine |