Online Database of Chemicals from Around the World
|
CAS#: 79817-62-2 Product: 4-Hydroxy-N-(3-Methoxypropyl)-3-Nitrobenzenesulfonamide No suppilers available for the product. |
| Name | 4-Hydroxy-N-(3-Methoxypropyl)-3-Nitrobenzenesulfonamide |
|---|---|
| Synonyms | 4-Hydroxy-N-(3-Methoxypropyl)-3-Nitro-Benzenesulfonamide; 4-Hydroxy-N-(3-Methoxypropyl)-3-Nitrobenzenesulphonamide |
| Molecular Structure |  |
| Molecular Formula | C10H14N2O6S |
| Molecular Weight | 290.29 |
| CAS Registry Number | 79817-62-2 |
| EINECS | 279-292-9 |
| SMILES | C1=C([S](=O)(=O)NCCCOC)C=CC(=C1[N+]([O-])=O)O |
| InChI | 1S/C10H14N2O6S/c1-18-6-2-5-11-19(16,17)8-3-4-10(13)9(7-8)12(14)15/h3-4,7,11,13H,2,5-6H2,1H3 |
| InChIKey | BPBAFZGGKPLCHG-UHFFFAOYSA-N |
| Density | 1.408g/cm3 (Cal.) |
|---|---|
| Boiling point | 438.138°C at 760 mmHg (Cal.) |
| Flash point | 218.779°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Hydroxy-N-(3-Methoxypropyl)-3-Nitrobenzenesulfonamide |