| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Trequinsin |
|---|---|
| Synonyms | 2-Mesitylimino-9,10-Dimethoxy-3-Methyl-6,7-Dihydropyrimido[4,3-A]Isoquinolin-4-One Hydrochloride; 9,10-Dimethoxy-2-Mesitylimino-3-Methyl-2,3,6,7-Tetrahydro-4H-Pyrimido-(6,1-A)-Isoquinolin-4-One, Hcl; Trequinsin, Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C24H28ClN3O3 |
| Molecular Weight | 441.96 |
| CAS Registry Number | 79855-88-2 |
| SMILES | [H+].C1=C(OC)C(=CC3=C1C2=CC(N(C(=O)N2CC3)C)=NC4=C(C=C(C=C4C)C)C)OC.[Cl-] |
| InChI | 1S/C24H27N3O3.ClH/c1-14-9-15(2)23(16(3)10-14)25-22-13-19-18-12-21(30-6)20(29-5)11-17(18)7-8-27(19)24(28)26(22)4;/h9-13H,7-8H2,1-6H3;1H |
| InChIKey | DTCZZBVPTHVXFA-UHFFFAOYSA-N |
| Boiling point | 593.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 312.6°C (Cal.) |
| solubility | Soluble to 100 mM in DMSO and to 100 mM in ethanol |
| Market Analysis Reports |
| List of Reports Available for Trequinsin |