Online Database of Chemicals from Around the World
| Paragos e. K. | Germany | Inquire | ||
|---|---|---|---|---|
 |
+49 2330-8079751 | |||
 |
sales@paragos.de | |||
| Chemical manufacturer since 2001 | ||||
| Name | Ethyl 3-(4-isopropylphenyl)propanoate |
|---|---|
| Synonyms | 3-(4-Isopropyl-phenyl)-propionic acid ethyl ester; ethyl 3-[4-(propan-2-yl)phenyl]propanoate |
| Molecular Structure |  |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 |
| CAS Registry Number | 79942-37-3 |
| SMILES | CCOC(=O)CCc1ccc(cc1)C(C)C |
| InChI | 1S/C14H20O2/c1-4-16-14(15)10-7-12-5-8-13(9-6-12)11(2)3/h5-6,8-9,11H,4,7,10H2,1-3H3 |
| InChIKey | ZTHNFRDYDYKVEY-UHFFFAOYSA-N |
| Density | 0.978g/cm3 (Cal.) |
|---|---|
| Boiling point | 293.973°C at 760 mmHg (Cal.) |
| Flash point | 106.153°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 3-(4-isopropylphenyl)propanoate |