Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | N-4-Methoxyphenylretinamide |
|---|---|
| Synonyms | 4-Mpr; Aids-210897; Aids210897 |
| Molecular Structure |  |
| Molecular Formula | C27H35NO2 |
| Molecular Weight | 405.58 |
| CAS Registry Number | 79965-10-9 |
| SMILES | C2=C(NC(=O)/C=C(\C=C\C=C(/C=C/C1=C(CCCC1(C)C)C)C)C)C=CC(=C2)OC |
| InChI | 1S/C27H35NO2/c1-20(12-17-25-22(3)11-8-18-27(25,4)5)9-7-10-21(2)19-26(29)28-23-13-15-24(30-6)16-14-23/h7,9-10,12-17,19H,8,11,18H2,1-6H3,(H,28,29)/b10-7+,17-12+,20-9-,21-19- |
| InChIKey | DBQHWMPFMCOGIW-GLKGMVBCSA-N |
| Density | 1.047g/cm3 (Cal.) |
|---|---|
| Boiling point | 585.279°C at 760 mmHg (Cal.) |
| Flash point | 307.766°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-4-Methoxyphenylretinamide |