| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() | www.purerechem.com | |||
![]() | +86 (551) 6288-8437 +86 18096409024 | |||
![]() | info@purerechem.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Trazodone Impurity I |
|---|---|
| Synonyms | 1,4-bis(3-chlorophenyl)piperazine |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16Cl2N2 |
| Molecular Weight | 307.22 |
| CAS Registry Number | 79975-63-6 |
| EC Number | 642-083-1 |
| SMILES | C1CN(CCN1C2=CC(=CC=C2)Cl)C3=CC(=CC=C3)Cl |
| Density | 1.3±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.617, Calc.* |
| Boiling Point | 467.8±45.0 °C (760 mmHg), Calc.* |
| Flash Point | 236.7±28.7 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Trazodone Impurity I |