Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+86 (21) 6141-5566 / 800-819-3336 | |||
|
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | alpha,alpha,4-Trimethyl-3-Cyclohexene-1-Methanol 1-Propanoate |
|---|---|
| Synonyms | [1-Methyl-1-(4-Methyl-1-Cyclohex-3-Enyl)Ethyl] Propanoate; Propanoic Acid [1-Methyl-1-(4-Methyl-1-Cyclohex-3-Enyl)Ethyl] Ester; Propionic Acid [1-Methyl-1-(4-Methyl-1-Cyclohex-3-Enyl)Ethyl] Ester |
| Molecular Structure |  |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 |
| CAS Registry Number | 80-27-3 |
| EINECS | 201-266-2 |
| FEMA | 3053 |
| SMILES | C(C(OC(C1CC=C(CC1)C)(C)C)=O)C |
| InChI | 1S/C13H22O2/c1-5-12(14)15-13(3,4)11-8-6-10(2)7-9-11/h6,11H,5,7-9H2,1-4H3 |
| InChIKey | CMKQOKAXUWQAHG-UHFFFAOYSA-N |
| Density | 0.954g/cm3 (Cal.) |
|---|---|
| Boiling point | 240°C (Expl.) |
| 258.94°C at 760 mmHg (Cal.) | |
| Flash point | 86.285°C (Cal.) |
| Refractive index | 1.462-1.468 (Expl.) |
| Market Analysis Reports |
| List of Reports Available for alpha,alpha,4-Trimethyl-3-Cyclohexene-1-Methanol 1-Propanoate |