Online Database of Chemicals from Around the World
|
CAS#: 80036-87-9 Product: 4-Bromo-2-(Ethylsulphonyl)-5-Methoxyaniline No suppilers available for the product. |
| Name | 4-Bromo-2-(Ethylsulphonyl)-5-Methoxyaniline |
|---|---|
| Synonyms | 4-Bromo-2-Ethylsulfonyl-5-Methoxy-Aniline; (4-Bromo-2-Ethylsulfonyl-5-Methoxy-Phenyl)Amine; 4-Bromo-2-(Ethylsulphonyl)-5-Methoxyaniline |
| Molecular Structure |  |
| Molecular Formula | C9H12BrNO3S |
| Molecular Weight | 294.16 |
| CAS Registry Number | 80036-87-9 |
| EINECS | 279-377-0 |
| SMILES | C1=C(Br)C(=CC(=C1[S](=O)(=O)CC)N)OC |
| InChI | 1S/C9H12BrNO3S/c1-3-15(12,13)9-4-6(10)8(14-2)5-7(9)11/h4-5H,3,11H2,1-2H3 |
| InChIKey | BNDGMKXNZXKLJR-UHFFFAOYSA-N |
| Density | 1.547g/cm3 (Cal.) |
|---|---|
| Boiling point | 446.087°C at 760 mmHg (Cal.) |
| Flash point | 223.586°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Bromo-2-(Ethylsulphonyl)-5-Methoxyaniline |