Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N'-(4-Methylphenyl)isonicotinohydrazide |
|---|---|
| Synonyms | N'-(p-tolyl)isonicotinohydrazide |
| Molecular Structure |  |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.26 |
| CAS Registry Number | 801158-45-2 |
| SMILES | Cc1ccc(cc1)NNC(=O)c2ccncc2 |
| InChI | 1S/C13H13N3O/c1-10-2-4-12(5-3-10)15-16-13(17)11-6-8-14-9-7-11/h2-9,15H,1H3,(H,16,17) |
| InChIKey | IUKROJCRFXMNHP-UHFFFAOYSA-N |
| Density | 1.218g/cm3 (Cal.) |
|---|---|
| Boiling point | 349.945°C at 760 mmHg (Cal.) |
| Flash point | 165.441°C (Cal.) |
| Refractive index | 1.641 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N'-(4-Methylphenyl)isonicotinohydrazide |