Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-(2,2-Difluoropropyl)benzoic acid |
|---|---|
| Synonyms | 4-(2,2-difluoropropyl)benzoic acid |
| Molecular Structure |  |
| Molecular Formula | C10H10F2O2 |
| Molecular Weight | 200.18 |
| CAS Registry Number | 801303-54-8 |
| SMILES | CC(Cc1ccc(cc1)C(=O)O)(F)F |
| InChI | 1S/C10H10F2O2/c1-10(11,12)6-7-2-4-8(5-3-7)9(13)14/h2-5H,6H2,1H3,(H,13,14) |
| InChIKey | VYRSLCGXROPJNM-UHFFFAOYSA-N |
| Density | 1.234g/cm3 (Cal.) |
|---|---|
| Boiling point | 289.647°C at 760 mmHg (Cal.) |
| Flash point | 128.974°C (Cal.) |
| Refractive index | 1.499 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2,2-Difluoropropyl)benzoic acid |