Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (2,8-Diamino-3H-purin-6-yl)methanol |
|---|---|
| Synonyms | (2,8-diamino-7H-purin-6-yl)methanol |
| Molecular Structure |  |
| Molecular Formula | C6H8N6O |
| Molecular Weight | 180.17 |
| CAS Registry Number | 802050-35-7 |
| SMILES | C(c1c2c(nc([nH]2)N)nc(n1)N)O |
| InChI | 1S/C6H8N6O/c7-5-9-2(1-13)3-4(11-5)12-6(8)10-3/h13H,1H2,(H5,7,8,9,10,11,12) |
| InChIKey | GXJNJAMPQQGSSY-UHFFFAOYSA-N |
| Density | 1.803g/cm3 (Cal.) |
|---|---|
| Boiling point | 689.446°C at 760 mmHg (Cal.) |
| Flash point | 370.764°C (Cal.) |
| Refractive index | 1.935 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,8-Diamino-3H-purin-6-yl)methanol |