Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-Ethyl-2,2-dimethyl-3-phenylpiperazine |
|---|---|
| Synonyms | 1-ethyl-2,2-dimethyl-3-phenylpiperazine; NSC407127 |
| Molecular Structure |  |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 |
| CAS Registry Number | 802254-39-3 |
| SMILES | c1(ccccc1)C2NCCN(CC)C2(C)C |
| InChI | 1S/C14H22N2/c1-4-16-11-10-15-13(14(16,2)3)12-8-6-5-7-9-12/h5-9,13,15H,4,10-11H2,1-3H3 |
| InChIKey | DLWQVUKPXRXNAM-UHFFFAOYSA-N |
| Density | 0.934g/cm3 (Cal.) |
|---|---|
| Boiling point | 310.613°C at 760 mmHg (Cal.) |
| Flash point | 113.579°C (Cal.) |
| Refractive index | 1.498 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Ethyl-2,2-dimethyl-3-phenylpiperazine |