Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2,2,3-Trimethyl-3-(trifluoromethyl)cyclopropanecarbonyl chloride |
|---|---|
| Synonyms | 2,2,3-tri |
| Molecular Structure |  |
| Molecular Formula | C8H10ClF3O |
| Molecular Weight | 214.61 |
| CAS Registry Number | 80255-76-1 |
| SMILES | CC1(C(C1(C)C(F)(F)F)C(=O)Cl)C |
| InChI | 1S/C8H10ClF3O/c1-6(2)4(5(9)13)7(6,3)8(10,11)12/h4H,1-3H3 |
| InChIKey | UTDSNHLGSFDMMF-UHFFFAOYSA-N |
| Density | 1.268g/cm3 (Cal.) |
|---|---|
| Boiling point | 149.568°C at 760 mmHg (Cal.) |
| Flash point | 44.257°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,3-Trimethyl-3-(trifluoromethyl)cyclopropanecarbonyl chloride |