Online Database of Chemicals from Around the World
|
CAS#: 80257-14-3 Product: 7-Fluoro-5-Chrysenemethanol No suppilers available for the product. |
| Name | 7-Fluoro-5-Chrysenemethanol |
|---|---|
| Synonyms | (7-Fluoro-5-Chrysenyl)Methanol; 5-Chrysenemethanol, 7-Fluoro-; 7-Fluoro-5-Chrysenemethanol |
| Molecular Structure |  |
| Molecular Formula | C19H13FO |
| Molecular Weight | 276.31 |
| CAS Registry Number | 80257-14-3 |
| SMILES | C1=C4C(=CC=C1)C3=C(C2=CC=CC(=C2C=C3CO)F)C=C4 |
| InChI | 1S/C19H13FO/c20-18-7-3-6-15-16-9-8-12-4-1-2-5-14(12)19(16)13(11-21)10-17(15)18/h1-10,21H,11H2 |
| InChIKey | XTCGUSLLQRJJMJ-UHFFFAOYSA-N |
| Density | 1.317g/cm3 (Cal.) |
|---|---|
| Boiling point | 516.741°C at 760 mmHg (Cal.) |
| Flash point | 318.09°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Fluoro-5-Chrysenemethanol |