Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N-[2-(2,3,5-Trimethylphenoxy)ethyl]cyclopropanamine |
|---|---|
| Synonyms | N-(2-(2,3,5-trimethylphenoxy)ethyl)cyclopropanamine |
| Molecular Structure | ![CAS#: 802834-89-5， N-[2-(2,3,5-Trimethylphenoxy)ethyl]cyclopropanamine](/moreStructures/802834-89-5.gif) |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.32 |
| CAS Registry Number | 802834-89-5 |
| SMILES | Cc1cc(c(c(c1)OCCNC2CC2)C)C |
| InChI | 1S/C14H21NO/c1-10-8-11(2)12(3)14(9-10)16-7-6-15-13-4-5-13/h8-9,13,15H,4-7H2,1-3H3 |
| InChIKey | DBMWCNNEPNDTML-UHFFFAOYSA-N |
| Density | 1.016g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.818°C at 760 mmHg (Cal.) |
| Flash point | 144.929°C (Cal.) |
| Refractive index | 1.534 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[2-(2,3,5-Trimethylphenoxy)ethyl]cyclopropanamine |