Online Database of Chemicals from Around the World
|
CAS#: 80284-77-1 Product: Bis(4-Methylumbelliferyl)Pyrophosphate No suppilers available for the product. |
| Name | Bis(4-Methylumbelliferyl)Pyrophosphate |
|---|---|
| Synonyms | Bis(4-Methyl-2-Oxo-Chromen-7-Yl) Phosphono Phosphate; Phosphoric Acid Bis(4-Methyl-2-Oxo-7-Chromenyl) Phosphono Ester; Phosphoric Acid Bis(2-Keto-4-Methyl-Chromen-7-Yl) Phosphono Ester |
| Molecular Structure |  |
| Molecular Formula | C20H16O11P2 |
| Molecular Weight | 494.29 |
| CAS Registry Number | 80284-77-1 |
| SMILES | C3=C(O[P](OC2=CC1=C(C(=CC(O1)=O)C)C=C2)(O[P](=O)(O)O)=O)C=CC4=C3OC(=O)C=C4C |
| InChI | 1S/C20H16O11P2/c1-11-7-19(21)27-17-9-13(3-5-15(11)17)29-33(26,31-32(23,24)25)30-14-4-6-16-12(2)8-20(22)28-18(16)10-14/h3-10H,1-2H3,(H2,23,24,25) |
| InChIKey | FNVBALFTMLKFEC-UHFFFAOYSA-N |
| Density | 1.614g/cm3 (Cal.) |
|---|---|
| Boiling point | 729.231°C at 760 mmHg (Cal.) |
| Flash point | 394.825°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(4-Methylumbelliferyl)Pyrophosphate |