Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 7,11-Dimethyl-11H-pyrido[2,1-b]quinazolin-11-ol |
|---|---|
| Synonyms | 7,11-dimethyl-11H-pyrido[2,1-b]quinazolin-11-ol |
| Molecular Structure | ![CAS#: 803651-99-2， 7,11-Dimethyl-11H-pyrido[2,1-b]quinazolin-11-ol](/moreStructures/803651-99-2.gif) |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.27 |
| CAS Registry Number | 803651-99-2 |
| SMILES | CC1=CC2=Nc3ccccc3C(N2C=C1)(C)O |
| InChI | 1S/C14H14N2O/c1-10-7-8-16-13(9-10)15-12-6-4-3-5-11(12)14(16,2)17/h3-9,17H,1-2H3 |
| InChIKey | VCAXAGXWDLCYAZ-UHFFFAOYSA-N |
| Density | 1.198g/cm3 (Cal.) |
|---|---|
| Boiling point | 404.396°C at 760 mmHg (Cal.) |
| Flash point | 198.372°C (Cal.) |
| Refractive index | 1.633 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,11-Dimethyl-11H-pyrido[2,1-b]quinazolin-11-ol |