|
CAS#: 80373-22-4 Product: Quinpirole No suppilers available for the product. |
| Name | Quinpirole |
|---|---|
| Synonyms | Lopac-Q-111; Ncgc00015866-02; Prestwick0_001093 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 |
| CAS Registry Number | 80373-22-4 |
| SMILES | [C@H]13[C@@H](CC2=C(C1)C=N[NH]2)CCCN3CCC |
| InChI | 1S/C13H21N3/c1-2-5-16-6-3-4-10-7-12-11(8-13(10)16)9-14-15-12/h9-10,13H,2-8H2,1H3,(H,14,15)/t10-,13-/m1/s1 |
| InChIKey | FTSUPYGMFAPCFZ-ZWNOBZJWSA-N |
| Density | 1.07g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.882°C at 760 mmHg (Cal.) |
| Flash point | 185.965°C (Cal.) |
| (1) | Han et al.. Allosteric communication between protomers of dopamine class A GPCR dimers modulates activation, Nature Chemical Biology, 2009 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Quinpirole |