Online Database of Chemicals from Around the World
|
CAS#: 80751-37-7 Product: 4-Chlorophenyl Methylphenylphosphinate No suppilers available for the product. |
| Name | 4-Chlorophenyl Methylphenylphosphinate |
|---|---|
| Synonyms | 1-Chloro-4-(Methyl-Phenyl-Phosphoryl)Oxy-Benzene; 4-Chlorophenyl Methylphenylphosphinate; Phosphinic Acid, Methylphenyl-, 4-Chlorophenyl Ester |
| Molecular Structure |  |
| Molecular Formula | C13H12ClO2P |
| Molecular Weight | 266.66 |
| CAS Registry Number | 80751-37-7 |
| SMILES | C1=CC=CC=C1[P](=O)(OC2=CC=C(C=C2)Cl)C |
| InChI | 1S/C13H12ClO2P/c1-17(15,13-5-3-2-4-6-13)16-12-9-7-11(14)8-10-12/h2-10H,1H3 |
| InChIKey | KOJPTJCTGSGDDL-UHFFFAOYSA-N |
| Density | 1.269g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.327°C at 760 mmHg (Cal.) |
| Flash point | 258.584°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chlorophenyl Methylphenylphosphinate |