Online Database of Chemicals from Around the World
|
CAS#: 80789-68-0 Product: 4-Bromoanilinium Bromide No suppilers available for the product. |
| Name | 4-Bromoanilinium Bromide |
|---|---|
| Synonyms | (4-Bromophenyl)Ammonium Bromide; 4-Bromoanilinium Bromide |
| Molecular Structure |  |
| Molecular Formula | C6H7Br2N |
| Molecular Weight | 252.94 |
| CAS Registry Number | 80789-68-0 |
| EINECS | 279-551-6 |
| SMILES | C1=C(Br)C=CC(=C1)[NH3+].[Br-] |
| InChI | 1S/C6H6BrN.BrH/c7-5-1-3-6(8)4-2-5;/h1-4H,8H2;1H |
| InChIKey | RVAONSPSAAMUMY-UHFFFAOYSA-N |
| Boiling point | 225.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 90.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Bromoanilinium Bromide |