Online Database of Chemicals from Around the World
|
CAS#: 80789-70-4 Product: 6-Amino-2-Phenylquinolin-4-Ol No suppilers available for the product. |
| Name | 6-Amino-2-Phenylquinolin-4-Ol |
|---|---|
| Synonyms | 6-Amino-2-Phenyl-4-Quinolone; 6-Amino-2-Phenylquinolin-4-Ol |
| Molecular Structure |  |
| Molecular Formula | C15H12N2O |
| Molecular Weight | 236.27 |
| CAS Registry Number | 80789-70-4 |
| EINECS | 279-553-7 |
| SMILES | C1=C(N)C=CC2=C1C(=O)C=C(N2)C3=CC=CC=C3 |
| InChI | 1S/C15H12N2O/c16-11-6-7-13-12(8-11)15(18)9-14(17-13)10-4-2-1-3-5-10/h1-9H,16H2,(H,17,18) |
| InChIKey | YYHYWCOWAWBTGE-UHFFFAOYSA-N |
| Density | 1.267g/cm3 (Cal.) |
|---|---|
| Boiling point | 464.584°C at 760 mmHg (Cal.) |
| Flash point | 234.772°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Amino-2-Phenylquinolin-4-Ol |