Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Toluene-4-Sulfonic Acid Dimethoxy-Phosphorylmethyl Ester |
|---|---|
| Synonyms | 4-Methylbenzenesulfonic Acid Dimethoxyphosphorylmethyl Ester; (Dimethoxyphosphoryl)Methyl 4-Methylbenzenesulfonate |
| Molecular Structure |  |
| Molecular Formula | C10H15O6PS |
| Molecular Weight | 294.26 |
| CAS Registry Number | 80792-13-8 |
| SMILES | C1=C([S](OC[P](OC)(OC)=O)(=O)=O)C=CC(=C1)C |
| InChI | 1S/C10H15O6PS/c1-9-4-6-10(7-5-9)18(12,13)16-8-17(11,14-2)15-3/h4-7H,8H2,1-3H3 |
| InChIKey | WGQMNJYLZXTHIN-UHFFFAOYSA-N |
| Density | 1.315g/cm3 (Cal.) |
|---|---|
| Boiling point | 418.953°C at 760 mmHg (Cal.) |
| Flash point | 207.175°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Toluene-4-Sulfonic Acid Dimethoxy-Phosphorylmethyl Ester |