Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1-Amino-2,4-Dihydroxyanthraquinone |
|---|---|
| Synonyms | 1-Amino-2,4-Dihydroxy-Anthracene-9,10-Dione; 1-Amino-2,4-Dihydroxy-9,10-Anthraquinone; 1A-2,4Doa |
| Molecular Structure |  |
| Molecular Formula | C14H9NO4 |
| Molecular Weight | 255.23 |
| CAS Registry Number | 81-51-6 |
| EINECS | 201-356-1 |
| SMILES | C3=C(O)C2=C(C(=O)C1=CC=CC=C1C2=O)C(=C3O)N |
| InChI | 1S/C14H9NO4/c15-12-9(17)5-8(16)10-11(12)14(19)7-4-2-1-3-6(7)13(10)18/h1-5,16-17H,15H2 |
| InChIKey | QUXBARPXUAPKDG-UHFFFAOYSA-N |
| Density | 1.613g/cm3 (Cal.) |
|---|---|
| Boiling point | 578.089°C at 760 mmHg (Cal.) |
| Flash point | 303.417°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Amino-2,4-Dihydroxyanthraquinone |