| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Lysine derivative |
|---|---|
| Name | N-alpha-Acetyl-L-Lysine-N-Methylamide Monohydrate |
| Synonyms | [(5S)-5-Acetamido-6-Methylamino-6-Oxo-Hexyl]Ammonium; [(5S)-5-Acetamido-6-Methylamino-6-Oxohexyl]Ammonium; [(5S)-5-Acetamido-6-Keto-6-Methylamino-Hexyl]Ammonium |
| Molecular Structure | ![]() |
| Molecular Formula | C9H20N3O2 |
| Molecular Weight | 202.28 |
| CAS Registry Number | 81013-00-5 |
| SMILES | [C@H](NC(=O)C)(CCCC[NH3+])C(=O)NC |
| InChI | 1S/C9H19N3O2/c1-7(13)12-8(9(14)11-2)5-3-4-6-10/h8H,3-6,10H2,1-2H3,(H,11,14)(H,12,13)/p+1/t8-/m0/s1 |
| InChIKey | FECUPDBTEVPIIE-QMMMGPOBSA-O |
| Boiling point | 483.157°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 246.005°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-alpha-Acetyl-L-Lysine-N-Methylamide Monohydrate |