Online Database of Chemicals from Around the World
| Name | 8-Chloro-Tetrahydroisoquinoline-7-Sulfonamide |
|---|---|
| Synonyms | 7-Isoquinolinesulfonamide, 8-Chloro-1,2,3,4-Tetrahydro-; 8-Chloro-Tetrahydroisoquinoline-7-Sulfonamide; Sk&F 83593 |
| Molecular Structure |  |
| Molecular Formula | C9H11ClN2O2S |
| Molecular Weight | 246.71 |
| CAS Registry Number | 81134-73-8 |
| SMILES | C1=CC(=C(C2=C1CCNC2)Cl)[S](=O)(=O)N |
| InChI | 1S/C9H11ClN2O2S/c10-9-7-5-12-4-3-6(7)1-2-8(9)15(11,13)14/h1-2,12H,3-5H2,(H2,11,13,14) |
| InChIKey | ZEUSRHFVPLVPCX-UHFFFAOYSA-N |
| Density | 1.424g/cm3 (Cal.) |
|---|---|
| Boiling point | 458.636°C at 760 mmHg (Cal.) |
| Flash point | 231.175°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Chloro-Tetrahydroisoquinoline-7-Sulfonamide |
