Online Database of Chemicals from Around the World
|
CAS#: 81257-95-6 Product: 1,7,8,9-Tetrahydro-5-Methoxypyrano(2,3-g)Indole No suppilers available for the product. |
| Name | 1,7,8,9-Tetrahydro-5-Methoxypyrano(2,3-g)Indole |
|---|---|
| Synonyms | 1,7,8,9-Tetrahydro-5-Methoxypyrano(2,3-G)Indole; 5-Methoxy-7,8,9-Trihydro-Pyranno(2,3-G)Indole [French]; Pyrano(2,3-G)Indole, 1,7,8,9-Tetrahydro-5-Methoxy- |
| Molecular Structure |  |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 |
| CAS Registry Number | 81257-95-6 |
| SMILES | C1=CC2=C([NH]1)C3=C(C(=C2)OC)OCCC3 |
| InChI | 1S/C12H13NO2/c1-14-10-7-8-4-5-13-11(8)9-3-2-6-15-12(9)10/h4-5,7,13H,2-3,6H2,1H3 |
| InChIKey | IBUDEGUREFQMAE-UHFFFAOYSA-N |
| Density | 1.241g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.38°C at 760 mmHg (Cal.) |
| Flash point | 144.137°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,7,8,9-Tetrahydro-5-Methoxypyrano(2,3-g)Indole |