Online Database of Chemicals from Around the World
|
CAS#: 81265-88-5 Product: 2-(2-Fluorophenyl)-2H-Indazole No suppilers available for the product. |
| Name | 2-(2-Fluorophenyl)-2H-Indazole |
|---|---|
| Synonyms | 2-(2-Fluorophenyl)-2H-Indazole; 2H-Indazole, 2-(2-Fluorophenyl)-; M.G. 18868 |
| Molecular Structure |  |
| Molecular Formula | C13H9FN2 |
| Molecular Weight | 212.23 |
| CAS Registry Number | 81265-88-5 |
| SMILES | C2=C1C=CC=CC1=N[N]2C3=CC=CC=C3F |
| InChI | 1S/C13H9FN2/c14-11-6-2-4-8-13(11)16-9-10-5-1-3-7-12(10)15-16/h1-9H |
| InChIKey | XOMWRLPGRHGMLM-UHFFFAOYSA-N |
| Density | 1.214g/cm3 (Cal.) |
|---|---|
| Boiling point | 236.713°C at 760 mmHg (Cal.) |
| Flash point | 96.961°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2-Fluorophenyl)-2H-Indazole |