Online Database of Chemicals from Around the World
|
CAS#: 81265-89-6 Product: 2-(3-Methoxyphenyl)-2H-Indazole No suppilers available for the product. |
| Name | 2-(3-Methoxyphenyl)-2H-Indazole |
|---|---|
| Synonyms | 2-(3-Methoxyphenyl)-2H-Indazole; 2H-Indazole, 2-(3-Methoxyphenyl)-; M.G. 18843 |
| Molecular Structure |  |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 |
| CAS Registry Number | 81265-89-6 |
| SMILES | C2=C1C=CC=CC1=N[N]2C3=CC=CC(=C3)OC |
| InChI | 1S/C14H12N2O/c1-17-13-7-4-6-12(9-13)16-10-11-5-2-3-8-14(11)15-16/h2-10H,1H3 |
| InChIKey | JNQANLFHMOCZAS-UHFFFAOYSA-N |
| Density | 1.158g/cm3 (Cal.) |
|---|---|
| Boiling point | 283.204°C at 760 mmHg (Cal.) |
| Flash point | 125.077°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3-Methoxyphenyl)-2H-Indazole |