Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1-Nitrocoronene |
|---|---|
| Synonyms | Brn 3450484; Coronene, 1-Nitro-; 3-05-00-02652 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C24H11NO2 |
| Molecular Weight | 345.36 |
| CAS Registry Number | 81316-84-9 |
| SMILES | C1=C6C=CC5=CC=C4C=CC3=CC=C2C=CC(=C1[N+]([O-])=O)C7=C2C3=C4C5=C67 |
| InChI | 1S/C24H11NO2/c26-25(27)18-11-16-8-7-14-4-2-12-1-3-13-5-6-15-9-10-17(18)24-22(15)20(13)19(12)21(14)23(16)24/h1-11H |
| InChIKey | MIKASNJPHHKWQC-UHFFFAOYSA-N |
| Density | 1.595g/cm3 (Cal.) |
|---|---|
| Boiling point | 587.719°C at 760 mmHg (Cal.) |
| Flash point | 289.122°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Nitrocoronene |