| Shanghai Rui Yun Chemical Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.rychemical.com.cn | |||
![]() | +86 (21) 6726-7633 | |||
![]() | +86 (21) 6726-7655 | |||
![]() | sales@rychemical.com.cn | |||
![]() | WeChat: 13917251563 | |||
| Chemical manufacturer since 2009 | ||||
| chemBlink Premium supplier since 2009 | ||||
| Classification | Organic raw materials >> Alcohols, phenols, phenolic compounds and derivatives |
|---|---|
| Name | Potassium tetrafluoro(2-fluorosulfonyl)-1-ethanolate |
| Molecular Structure | ![]() |
| Molecular Formula | C2F5KO3S |
| Molecular Weight | 238.17 |
| CAS Registry Number | 81439-24-9 |
| SMILES | C(C([S](=O)(=O)F)(F)F)([O-])(F)F.[K+] |
|
Potassium tetrafluoro(2-fluorosulfonyl)-1-ethanolate is a notable compound in the field of fluorinated chemistry. It consists of a potassium salt of tetrafluoro(2-fluorosulfonyl)-1-ethanol, and is used primarily for its unique reactivity and applications in various chemical processes. The discovery of potassium tetrafluoro(2-fluorosulfonyl)-1-ethanolate is rooted in the broader exploration of fluorinated compounds, which began in the early 20th century as scientists sought to understand and harness the unique properties of fluorine. Fluorinated compounds, due to the strong bonds formed between carbon and fluorine, exhibit remarkable chemical stability and are often used in applications requiring durability and resistance to chemical attack. The specific compound in question emerged from research into fluorinated alcohols and their derivatives, aiming to enhance the reactivity and functional versatility of these substances. Potassium tetrafluoro(2-fluorosulfonyl)-1-ethanolate is synthesized through the reaction of tetrafluoro(2-fluorosulfonyl)-1-ethanol with potassium hydroxide. The process involves careful control of reaction conditions to ensure the formation of the potassium salt. This synthesis is of particular interest due to the compound's ability to act as a strong base and nucleophile, properties that are useful in a variety of chemical reactions. One significant application of potassium tetrafluoro(2-fluorosulfonyl)-1-ethanolate is in organic synthesis, where it serves as a reagent for the introduction of fluorinated groups into organic molecules. The presence of both tetrafluoro and fluorosulfonyl groups imparts unique reactivity, making it valuable for modifying the structure and properties of target compounds. This capability is especially useful in the synthesis of pharmaceuticals, agrochemicals, and advanced materials, where the introduction of fluorinated groups can enhance the performance and stability of the final products. The compound is also utilized in the development of fluorinated materials. The incorporation of fluorinated moieties into polymers and other materials can significantly improve their chemical resistance, thermal stability, and overall durability. Potassium tetrafluoro(2-fluorosulfonyl)-1-ethanolate is employed in processes that modify polymer matrices to achieve these enhanced properties. These materials find applications in high-performance coatings, adhesives, and insulation. In addition to its practical applications, potassium tetrafluoro(2-fluorosulfonyl)-1-ethanolate plays a role in advancing the understanding of fluorinated compounds. Researchers use this compound to study the behavior of fluorinated functional groups, their reactivity, and their interactions with other chemical entities. Such studies contribute to the development of new synthetic methods and the discovery of novel applications for fluorinated compounds. Safety considerations are important when handling potassium tetrafluoro(2-fluorosulfonyl)-1-ethanolate. Proper storage and handling protocols should be followed to avoid exposure and ensure safe use. The compound should be handled in a well-ventilated area, with appropriate personal protective equipment used to prevent contact with skin and eyes. Overall, potassium tetrafluoro(2-fluorosulfonyl)-1-ethanolate is a valuable compound in fluorinated chemistry, with significant applications in organic synthesis, materials science, and chemical research. Its unique properties and reactivity make it a useful tool for developing advanced materials and exploring the potential of fluorinated substances. References none |
| Market Analysis Reports |
| List of Reports Available for Potassium tetrafluoro(2-fluorosulfonyl)-1-ethanolate |