Online Database of Chemicals from Around the World
|
CAS#: 81445-91-2 Product: N-Demethylmenogaril No suppilers available for the product. |
| Name | N-Demethylmenogaril |
|---|---|
| Synonyms | N-Demethylmenogaril |
| Molecular Structure |  |
| Molecular Formula | C27H29NO10 |
| Molecular Weight | 527.53 |
| CAS Registry Number | 81445-91-2 |
| SMILES | [C@@]16(O[C@@H](OC2=C3C(=C(O)C=C12)C(=O)C4=C(C3=O)C=C5C(=C4O)[C@H](OC)C[C@@](O)(C5)C)[C@@H](O)[C@@H](NC)[C@H]6O)C |
| InChI | 1S/C27H29NO10/c1-26(35)7-9-5-10-15(20(31)14(9)13(8-26)36-4)21(32)16-12(29)6-11-23(17(16)19(10)30)37-25-22(33)18(28-3)24(34)27(11,2)38-25/h5-6,13,18,22,24-25,28-29,31,33-35H,7-8H2,1-4H3/t13-,18-,22+,24-,25-,26+,27+/m1/s1 |
| InChIKey | PPUCUNKHOFYRLN-FJSFXKJISA-N |
| Density | 1.623g/cm3 (Cal.) |
|---|---|
| Boiling point | 809.025°C at 760 mmHg (Cal.) |
| Flash point | 443.082°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Demethylmenogaril |