Online Database of Chemicals from Around the World
|
CAS#: 81482-43-1 Product: 18-Deoxynargenicin A1 No suppilers available for the product. |
| Name | 18-Deoxynargenicin A1 |
|---|---|
| Synonyms | Nodusmicin, 18-Deoxy-, 9-(1H-Pyrrole-2-Carboxylate) |
| Molecular Structure |  |
| Molecular Formula | C28H37NO7 |
| Molecular Weight | 499.60 |
| CAS Registry Number | 81482-43-1 |
| SMILES | [C@H]15C23O[C@H]([C@@H]1C=C[C@@H]2C[C@H](OC)C(O[C@@H]([C@@H](/C=C3/C)C)CC)=O)[C@H](OC(=O)C4=CC=C[NH]4)[C@@H]([C@H]5O)C |
| InChI | 1S/C28H37NO7/c1-6-20-14(2)12-15(3)28-17(13-21(33-5)27(32)34-20)9-10-18-22(28)23(30)16(4)24(25(18)36-28)35-26(31)19-8-7-11-29-19/h7-12,14,16-18,20-25,29-30H,6,13H2,1-5H3/b15-12-/t14-,16-,17-,18-,20-,21+,22+,23-,24-,25-,28?/m1/s1 |
| InChIKey | URZYTTZFJXYNJG-FHARIZMYSA-N |
| Density | 1.269g/cm3 (Cal.) |
|---|---|
| Boiling point | 687.588°C at 760 mmHg (Cal.) |
| Flash point | 369.64°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 18-Deoxynargenicin A1 |