Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N-3H-Indol-2-ylsulfuric diamide |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C8H9N3O2S |
| Molecular Weight | 211.24 |
| CAS Registry Number | 81559-69-5 |
| SMILES | c1ccc2c(c1)CC(=N2)NS(=O)(=O)N |
| InChI | 1S/C8H9N3O2S/c9-14(12,13)11-8-5-6-3-1-2-4-7(6)10-8/h1-4H,5H2,(H,10,11)(H2,9,12,13) |
| InChIKey | YCYPXHZNLFTQBG-UHFFFAOYSA-N |
| Density | 1.614g/cm3 (Cal.) |
|---|---|
| Boiling point | 432.221°C at 760 mmHg (Cal.) |
| Flash point | 215.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-3H-Indol-2-ylsulfuric diamide |