Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-Phenyl-7-chromanol |
|---|---|
| Synonyms | 3-phenylchroman-7-ol |
| Molecular Structure |  |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.27 |
| CAS Registry Number | 81715-96-0 |
| SMILES | C1C(COC2=C1C=CC(=C2)O)C3=CC=CC=C3 |
| InChI | 1S/C15H14O2/c16-14-7-6-12-8-13(10-17-15(12)9-14)11-4-2-1-3-5-11/h1-7,9,13,16H,8,10H2 |
| InChIKey | LKMWTIGVJAWQHQ-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 382.1±31.0°C at 760 mmHg (Cal.) |
| Flash point | 176.5±19.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Phenyl-7-chromanol |