|
CAS#: 81739-40-4 Product: S-Nitroso-N-Acetyl-DL-Penicillamine No suppilers available for the product. |
| Name | S-Nitroso-N-Acetyl-DL-Penicillamine |
|---|---|
| Synonyms | 2-Acetamido-3-Methyl-3-Nitrososulfanyl-Butanoic Acid; 2-Acetamido-3-Methyl-3-(Nitrosothio)Butanoic Acid; 2-Acetamido-3-Methyl-3-(Nitrosothio)Butyric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C7H12N2O4S |
| Molecular Weight | 220.24 |
| CAS Registry Number | 81739-40-4 |
| SMILES | CC(C(NC(C)=O)C(O)=O)(SN=O)C |
| InChI | 1S/C7H12N2O4S/c1-4(10)8-5(6(11)12)7(2,3)14-9-13/h5H,1-3H3,(H,8,10)(H,11,12) |
| InChIKey | ZIIQCSMRQKCOCT-UHFFFAOYSA-N |
| Density | 1.367g/cm3 (Cal.) |
|---|---|
| solubility | Soluble to 100 mM in DMSO |
| Market Analysis Reports |
| List of Reports Available for S-Nitroso-N-Acetyl-DL-Penicillamine |