Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | DL-2-Amino-8-Phosphonooctanoic Acid |
|---|---|
| Synonyms | 2-Amino-8-Phosphono-Octanoic Acid; 2-Amino-8-Phosphono-Caprylic Acid; 2-Ap8 |
| Molecular Structure |  |
| Molecular Formula | C8H18NO5P |
| Molecular Weight | 239.21 |
| CAS Registry Number | 81771-84-8 |
| SMILES | C([P](O)(O)=O)CCCCCC(C(O)=O)N |
| InChI | 1S/C8H18NO5P/c9-7(8(10)11)5-3-1-2-4-6-15(12,13)14/h7H,1-6,9H2,(H,10,11)(H2,12,13,14) |
| InChIKey | KGGCRFYWXLVUQQ-UHFFFAOYSA-N |
| Density | 1.341g/cm3 (Cal.) |
|---|---|
| Boiling point | 483.549°C at 760 mmHg (Cal.) |
| Flash point | 246.242°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for DL-2-Amino-8-Phosphonooctanoic Acid |