Online Database of Chemicals from Around the World
|
CAS#: 81949-88-4 Product: 1-(3,5-Dichlorophenyl)-3-(Methoxymethyl)Pyrrolidine-2,5-Dione No suppilers available for the product. |
| Name | 1-(3,5-Dichlorophenyl)-3-(Methoxymethyl)Pyrrolidine-2,5-Dione |
|---|---|
| Synonyms | 1-(3,5-Dichlorophenyl)-3-(Methoxymethyl)Pyrrolidine-2,5-Quinone |
| Molecular Structure |  |
| Molecular Formula | C12H11Cl2NO3 |
| Molecular Weight | 288.13 |
| CAS Registry Number | 81949-88-4 |
| EINECS | 279-856-4 |
| SMILES | C1=C(C=C(C=C1N2C(C(CC2=O)COC)=O)Cl)Cl |
| InChI | 1S/C12H11Cl2NO3/c1-18-6-7-2-11(16)15(12(7)17)10-4-8(13)3-9(14)5-10/h3-5,7H,2,6H2,1H3 |
| InChIKey | GKRWQTZYSYFMOV-UHFFFAOYSA-N |
| Density | 1.407g/cm3 (Cal.) |
|---|---|
| Boiling point | 499.601°C at 760 mmHg (Cal.) |
| Flash point | 255.95°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3,5-Dichlorophenyl)-3-(Methoxymethyl)Pyrrolidine-2,5-Dione |