| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Ethyl 6-hydroxy-3,3-dimethyl-2-oxocyclohexanecarboxylate |
|---|---|
| Synonyms | Ethyl 6-hydroxy-3,3-dimethyl-2-oxo-cyclohexanecarboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 |
| CAS Registry Number | 819796-37-7 |
| SMILES | CCOC(=O)C1C(CCC(C1=O)(C)C)O |
| InChI | 1S/C11H18O4/c1-4-15-10(14)8-7(12)5-6-11(2,3)9(8)13/h7-8,12H,4-6H2,1-3H3 |
| InChIKey | AYJRDMLQRLVBGS-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 312.7±42.0°C at 760 mmHg (Cal.) |
| Flash point | 114.7±21.4°C (Cal.) |
| Refractive index | 1.476 (Cal.) |
| (1) | Mark D. Keränen, Kinga Kot, Christoph Hollmann and Peter Eilbracht. Sequential hydroformylation/aldol reactions: versatile and controllable access to functionalised carbocycles from unsaturated carbonyl compounds, Org. Biomol. Chem., 2004, 2, 3379. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Ethyl 6-hydroxy-3,3-dimethyl-2-oxocyclohexanecarboxylate |