Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-Ethyl-1-mesitylthiourea |
|---|---|
| Synonyms | 1-ethyl-1-mesitylthiourea; THIOUREA,N-ETHYL-N'-(2,4,6-TRIMETHYLPHENYL)- |
| Molecular Structure |  |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.35 |
| CAS Registry Number | 819818-85-4 |
| SMILES | CCN(c1c(cc(cc1C)C)C)C(=S)N |
| InChI | 1S/C12H18N2S/c1-5-14(12(13)15)11-9(3)6-8(2)7-10(11)4/h6-7H,5H2,1-4H3,(H2,13,15) |
| InChIKey | MIQJBSBVFIKNPF-UHFFFAOYSA-N |
| Density | 1.104g/cm3 (Cal.) |
|---|---|
| Boiling point | 342.285°C at 760 mmHg (Cal.) |
| Flash point | 160.809°C (Cal.) |
| Refractive index | 1.617 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Ethyl-1-mesitylthiourea |